C32H30O6S2 — CID 12556923
[(15S,16S)-16-[(4-methylphenyl)sulfonyloxymethyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl 4-methylbenzenesulfonate (PubChem CID 12556923) has the molecular formula C32H30O6S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is [(15S,16S)-16-[(4-methylphenyl)sulfonyloxymethyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(15S,16S)-16-[(4-methylphenyl)sulfonyloxymethyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12556923 |
| Molecular Formula | C32H30O6S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | [(15S,16S)-16-[(4-methylphenyl)sulfonyloxymethyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H30O6S2/c1-21-11-15-23(16-12-21)39(33,34)37-19-29-30(20-38-40(35,36)24-17-13-22(2)14-18-24)32-27-9-5-3-7-25(27)31(29)26-8-4-6-10-28(26)32/h3-18,29-32H,19-20H2,1-2H3/t29-,30-,31?,32?/m1/s1 |
| InChIKey | MFWDRSLVFMXUPO-NXFCCEIPSA-N |
| XLogP | 5.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|