C23H20O3S — CID 5239141
15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl 4-methylbenzenesulfonate (PubChem CID 5239141) has the molecular formula C23H20O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl 4-methylbenzenesulfonate.
| Compound Name | 15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 5239141 |
| Molecular Formula | C23H20O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC3c4ccccc4C2c2ccccc23)cc1 |
| InChI | InChI=1S/C23H20O3S/c1-15-10-12-16(13-11-15)27(24,25)26-22-14-21-17-6-2-4-8-19(17)23(22)20-9-5-3-7-18(20)21/h2-13,21-23H,14H2,1H3 |
| InChIKey | SFDMJXPUDHKTQH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|