C23H24O6S2 — CID 89361001
[(2R)-7-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 89361001) has the molecular formula C23H24O6S2 and a molecular weight of 460.57 g/mol. Its IUPAC name is [(2R)-7-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R)-7-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89361001 |
| Molecular Formula | C23H24O6S2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [(2R)-7-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CCc3ccc(S(=O)(=O)C4C=CC=CC4)cc3O2)cc1 |
| InChI | InChI=1S/C23H24O6S2/c1-17-7-12-21(13-8-17)31(26,27)28-16-19-11-9-18-10-14-22(15-23(18)29-19)30(24,25)20-5-3-2-4-6-20/h2-5,7-8,10,12-15,19-20H,6,9,11,16H2,1H3/t19-,20?/m1/s1 |
| InChIKey | IDJMCBYKKTZGTF-FIWHBWSRSA-N |
| XLogP | 3.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|