C18H20O4S — CID 14838443
2-(3,4-dihydro-2H-chromen-2-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 14838443) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-2-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3,4-dihydro-2H-chromen-2-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14838443 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-2-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2CCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H20O4S/c1-14-6-10-17(11-7-14)23(19,20)21-13-12-16-9-8-15-4-2-3-5-18(15)22-16/h2-7,10-11,16H,8-9,12-13H2,1H3 |
| InChIKey | IZUDSWHDINRNAI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|