C18H21NO6S2 — CID 10573685
[7-(methanesulfonamido)-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10573685) has the molecular formula C18H21NO6S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is [7-(methanesulfonamido)-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(methanesulfonamido)-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10573685 |
| Molecular Formula | C18H21NO6S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [7-(methanesulfonamido)-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCc3ccc(NS(C)(=O)=O)cc3O2)cc1 |
| InChI | InChI=1S/C18H21NO6S2/c1-13-3-9-17(10-4-13)27(22,23)24-12-16-8-6-14-5-7-15(11-18(14)25-16)19-26(2,20)21/h3-5,7,9-11,16,19H,6,8,12H2,1-2H3 |
| InChIKey | LXIGODQWVGQMSS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|