C23H19Cl2FO4S — CID 87701528
[8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87701528) has the molecular formula C23H19Cl2FO4S and a molecular weight of 481.37 g/mol. Its IUPAC name is [8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87701528 |
| Molecular Formula | C23H19Cl2FO4S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | [8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCc3cc(F)cc(-c4c(Cl)cccc4Cl)c3O2)cc1 |
| InChI | InChI=1S/C23H19Cl2FO4S/c1-14-5-9-18(10-6-14)31(27,28)29-13-17-8-7-15-11-16(26)12-19(23(15)30-17)22-20(24)3-2-4-21(22)25/h2-6,9-12,17H,7-8,13H2,1H3 |
| InChIKey | IPMZDPVCAPMGAU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|