C22H18ClFO4S — CID 86599286
[7-(2-chlorophenyl)-6-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599286) has the molecular formula C22H18ClFO4S and a molecular weight of 432.90 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-6-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(2-chlorophenyl)-6-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599286 |
| Molecular Formula | C22H18ClFO4S |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | [7-(2-chlorophenyl)-6-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3ccc(F)c(-c4ccccc4Cl)c3O2)cc1 |
| InChI | InChI=1S/C22H18ClFO4S/c1-14-6-9-17(10-7-14)29(25,26)27-13-16-12-15-8-11-20(24)21(22(15)28-16)18-4-2-3-5-19(18)23/h2-11,16H,12-13H2,1H3 |
| InChIKey | WPHBQBLRMCVNRQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|