C22H19FO4S — CID 86599111
(4-fluoro-7-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate (PubChem CID 86599111) has the molecular formula C22H19FO4S and a molecular weight of 398.46 g/mol. Its IUPAC name is (4-fluoro-7-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (4-fluoro-7-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599111 |
| Molecular Formula | C22H19FO4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (4-fluoro-7-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3c(F)ccc(-c4ccccc4)c3O2)cc1 |
| InChI | InChI=1S/C22H19FO4S/c1-15-7-9-18(10-8-15)28(24,25)26-14-17-13-20-21(23)12-11-19(22(20)27-17)16-5-3-2-4-6-16/h2-12,17H,13-14H2,1H3 |
| InChIKey | SAJVISINUMKWPT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|