C17H15F3O7S2 — CID 86599077
[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599077) has the molecular formula C17H15F3O7S2 and a molecular weight of 452.43 g/mol. Its IUPAC name is [7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599077 |
| Molecular Formula | C17H15F3O7S2 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | [7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3cccc(OS(=O)(=O)C(F)(F)F)c3O2)cc1 |
| InChI | InChI=1S/C17H15F3O7S2/c1-11-5-7-14(8-6-11)28(21,22)25-10-13-9-12-3-2-4-15(16(12)26-13)27-29(23,24)17(18,19)20/h2-8,13H,9-10H2,1H3 |
| InChIKey | HZEYSBBHHZIEAQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|