C23H21ClO4S — CID 86599322
[7-(4-chlorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599322) has the molecular formula C23H21ClO4S and a molecular weight of 428.94 g/mol. Its IUPAC name is [7-(4-chlorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(4-chlorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599322 |
| Molecular Formula | C23H21ClO4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [7-(4-chlorophenyl)-5-methyl-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3cc(C)cc(-c4ccc(Cl)cc4)c3O2)cc1 |
| InChI | InChI=1S/C23H21ClO4S/c1-15-3-9-21(10-4-15)29(25,26)27-14-20-13-18-11-16(2)12-22(23(18)28-20)17-5-7-19(24)8-6-17/h3-12,20H,13-14H2,1-2H3 |
| InChIKey | FGPUDCIZDXJGFA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|