C23H21ClO5S — CID 86599331
[7-(2-chlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599331) has the molecular formula C23H21ClO5S and a molecular weight of 444.94 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(2-chlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599331 |
| Molecular Formula | C23H21ClO5S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [7-(2-chlorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1cc2c(c(-c3ccccc3Cl)c1)OC(COS(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C23H21ClO5S/c1-15-7-9-19(10-8-15)30(25,26)28-14-18-12-16-11-17(27-2)13-21(23(16)29-18)20-5-3-4-6-22(20)24/h3-11,13,18H,12,14H2,1-2H3 |
| InChIKey | MMBDSZGYHMWKLU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|