C21H16ClFO5S — CID 86608724
[4-(2-chlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86608724) has the molecular formula C21H16ClFO5S and a molecular weight of 434.87 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [4-(2-chlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86608724 |
| Molecular Formula | C21H16ClFO5S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | [4-(2-chlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Oc3cc(F)cc(-c4ccccc4Cl)c3O2)cc1 |
| InChI | InChI=1S/C21H16ClFO5S/c1-13-6-8-15(9-7-13)29(24,25)26-12-20-27-19-11-14(23)10-17(21(19)28-20)16-4-2-3-5-18(16)22/h2-11,20H,12H2,1H3 |
| InChIKey | QWAXAOXQJBTWOX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|