C23H21ClO7S — CID 86608700
[6-chloro-4-(2,3-dimethoxyphenyl)-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86608700) has the molecular formula C23H21ClO7S and a molecular weight of 476.93 g/mol. Its IUPAC name is [6-chloro-4-(2,3-dimethoxyphenyl)-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [6-chloro-4-(2,3-dimethoxyphenyl)-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86608700 |
| Molecular Formula | C23H21ClO7S |
| Molecular Weight | 476.93 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | [6-chloro-4-(2,3-dimethoxyphenyl)-1,3-benzodioxol-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1cccc(-c2cc(Cl)cc3c2OC(COS(=O)(=O)c2ccc(C)cc2)O3)c1OC |
| InChI | InChI=1S/C23H21ClO7S/c1-14-7-9-16(10-8-14)32(25,26)29-13-21-30-20-12-15(24)11-18(23(20)31-21)17-5-4-6-19(27-2)22(17)28-3/h4-12,21H,13H2,1-3H3 |
| InChIKey | QJSRTCYVBLLXTF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.93 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|