C24H21Cl2FO4S — CID 86609130
[(2R)-9-(2,6-dichlorophenyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86609130) has the molecular formula C24H21Cl2FO4S and a molecular weight of 495.40 g/mol. Its IUPAC name is [(2R)-9-(2,6-dichlorophenyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R)-9-(2,6-dichlorophenyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86609130 |
| Molecular Formula | C24H21Cl2FO4S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | [(2R)-9-(2,6-dichlorophenyl)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CCCc3cc(F)cc(-c4c(Cl)cccc4Cl)c3O2)cc1 |
| InChI | InChI=1S/C24H21Cl2FO4S/c1-15-8-10-19(11-9-15)32(28,29)30-14-18-5-2-4-16-12-17(27)13-20(24(16)31-18)23-21(25)6-3-7-22(23)26/h3,6-13,18H,2,4-5,14H2,1H3/t18-/m1/s1 |
| InChIKey | QZAZRCZCUWOMAE-GOSISDBHSA-N |
| XLogP | 6.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|