C24H24O4S — CID 86599150
[7-(2,5-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599150) has the molecular formula C24H24O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is [7-(2,5-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-(2,5-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599150 |
| Molecular Formula | C24H24O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [7-(2,5-dimethylphenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3cccc(-c4cc(C)ccc4C)c3O2)cc1 |
| InChI | InChI=1S/C24H24O4S/c1-16-8-11-21(12-9-16)29(25,26)27-15-20-14-19-5-4-6-22(24(19)28-20)23-13-17(2)7-10-18(23)3/h4-13,20H,14-15H2,1-3H3 |
| InChIKey | RCMDSMKGRXKQPR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|