C16H12Cl2FN3O — CID 86609116
(2R)-2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromene (PubChem CID 86609116) has the molecular formula C16H12Cl2FN3O and a molecular weight of 352.20 g/mol. Its IUPAC name is (2R)-2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromene.
| Compound Name | (2R)-2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 86609116 |
| Molecular Formula | C16H12Cl2FN3O |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (2R)-2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-3,4-dihydro-2H-chromene |
| SMILES | [N-]=[N+]=NC[C@H]1CCc2cc(F)cc(-c3c(Cl)cccc3Cl)c2O1 |
| InChI | InChI=1S/C16H12Cl2FN3O/c17-13-2-1-3-14(18)15(13)12-7-10(19)6-9-4-5-11(8-21-22-20)23-16(9)12/h1-3,6-7,11H,4-5,8H2/t11-/m1/s1 |
| InChIKey | ARFMNHCULXEEID-LLVKDONJSA-N |
| XLogP | 5.80 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|