C16H13ClFN3O — CID 86604656
2-(azidomethyl)-7-(5-chloro-2-methylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran (PubChem CID 86604656) has the molecular formula C16H13ClFN3O and a molecular weight of 317.75 g/mol. Its IUPAC name is 2-(azidomethyl)-7-(5-chloro-2-methylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran.
| Compound Name | 2-(azidomethyl)-7-(5-chloro-2-methylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 86604656 |
| Molecular Formula | C16H13ClFN3O |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-(azidomethyl)-7-(5-chloro-2-methylphenyl)-5-fluoro-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(Cl)cc1-c1cc(F)cc2c1OC(CN=[N+]=[N-])C2 |
| InChI | InChI=1S/C16H13ClFN3O/c1-9-2-3-11(17)6-14(9)15-7-12(18)4-10-5-13(8-20-21-19)22-16(10)15/h2-4,6-7,13H,5,8H2,1H3 |
| InChIKey | HTDHIDGUXLATBI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|