C13H10ClN3OS — CID 86599109
2-(azidomethyl)-5-chloro-7-thiophen-3-yl-2,3-dihydro-1-benzofuran (PubChem CID 86599109) has the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-(azidomethyl)-5-chloro-7-thiophen-3-yl-2,3-dihydro-1-benzofuran.
| Compound Name | 2-(azidomethyl)-5-chloro-7-thiophen-3-yl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 86599109 |
| Molecular Formula | C13H10ClN3OS |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-(azidomethyl)-5-chloro-7-thiophen-3-yl-2,3-dihydro-1-benzofuran |
| SMILES | [N-]=[N+]=NCC1Cc2cc(Cl)cc(-c3ccsc3)c2O1 |
| InChI | InChI=1S/C13H10ClN3OS/c14-10-3-9-4-11(6-16-17-15)18-13(9)12(5-10)8-1-2-19-7-8/h1-3,5,7,11H,4,6H2 |
| InChIKey | IYNPDDDDTRQWNZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|