C15H12ClN3O — CID 86599204
2-(azidomethyl)-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran (PubChem CID 86599204) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(azidomethyl)-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 2-(azidomethyl)-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 86599204 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(azidomethyl)-7-(2-chlorophenyl)-2,3-dihydro-1-benzofuran |
| SMILES | [N-]=[N+]=NCC1Cc2cccc(-c3ccccc3Cl)c2O1 |
| InChI | InChI=1S/C15H12ClN3O/c16-14-7-2-1-5-12(14)13-6-3-4-10-8-11(9-18-19-17)20-15(10)13/h1-7,11H,8-9H2 |
| InChIKey | JOSVMSHSOBTJBX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|