C19H19ClN4O — CID 86638889
2-(azidomethyl)-8-(2-chlorophenyl)-4-(cyclopropylmethyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 86638889) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-(azidomethyl)-8-(2-chlorophenyl)-4-(cyclopropylmethyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 2-(azidomethyl)-8-(2-chlorophenyl)-4-(cyclopropylmethyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 86638889 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(azidomethyl)-8-(2-chlorophenyl)-4-(cyclopropylmethyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | [N-]=[N+]=NCC1CN(CC2CC2)c2cccc(-c3ccccc3Cl)c2O1 |
| InChI | InChI=1S/C19H19ClN4O/c20-17-6-2-1-4-15(17)16-5-3-7-18-19(16)25-14(10-22-23-21)12-24(18)11-13-8-9-13/h1-7,13-14H,8-12H2 |
| InChIKey | AOYJJDHOULWBPV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|