C16H15N3O2 — CID 90866841
3-(azidomethyl)-5-(2-methylphenyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 90866841) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-(azidomethyl)-5-(2-methylphenyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(azidomethyl)-5-(2-methylphenyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 90866841 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(azidomethyl)-5-(2-methylphenyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1ccccc1-c1cccc2c1OC(CN=[N+]=[N-])CO2 |
| InChI | InChI=1S/C16H15N3O2/c1-11-5-2-3-6-13(11)14-7-4-8-15-16(14)21-12(10-20-15)9-18-19-17/h2-8,12H,9-10H2,1H3 |
| InChIKey | AGYPPESHTDVLAF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|