C16H11ClF3N3O2 — CID 91134194
(3S)-3-(azidomethyl)-6-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 91134194) has the molecular formula C16H11ClF3N3O2 and a molecular weight of 369.73 g/mol. Its IUPAC name is (3S)-3-(azidomethyl)-6-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (3S)-3-(azidomethyl)-6-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 91134194 |
| Molecular Formula | C16H11ClF3N3O2 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (3S)-3-(azidomethyl)-6-chloro-5-[2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | [N-]=[N+]=NC[C@H]1COc2ccc(Cl)c(-c3ccccc3C(F)(F)F)c2O1 |
| InChI | InChI=1S/C16H11ClF3N3O2/c17-12-5-6-13-15(25-9(8-24-13)7-22-23-21)14(12)10-3-1-2-4-11(10)16(18,19)20/h1-6,9H,7-8H2/t9-/m0/s1 |
| InChIKey | VIJQVJLQAVXWDK-VIFPVBQESA-N |
| XLogP | 5.48 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|