C15H10Cl2FN3OS — CID 59378251
2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-2,3-dihydro-1,4-benzoxathiine (PubChem CID 59378251) has the molecular formula C15H10Cl2FN3OS and a molecular weight of 370.24 g/mol. Its IUPAC name is 2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-2,3-dihydro-1,4-benzoxathiine.
| Compound Name | 2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-2,3-dihydro-1,4-benzoxathiine |
|---|---|
| PubChem CID | 59378251 |
| Molecular Formula | C15H10Cl2FN3OS |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2-(azidomethyl)-8-(2,6-dichlorophenyl)-6-fluoro-2,3-dihydro-1,4-benzoxathiine |
| SMILES | [N-]=[N+]=NCC1CSc2cc(F)cc(-c3c(Cl)cccc3Cl)c2O1 |
| InChI | InChI=1S/C15H10Cl2FN3OS/c16-11-2-1-3-12(17)14(11)10-4-8(18)5-13-15(10)22-9(7-23-13)6-20-21-19/h1-5,9H,6-7H2 |
| InChIKey | CKJDXEDPPVHYIM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|