C14H9Cl2FO3 — CID 69259667
[4-(2,6-dichlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methanol (PubChem CID 69259667) has the molecular formula C14H9Cl2FO3 and a molecular weight of 315.13 g/mol. Its IUPAC name is [4-(2,6-dichlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methanol.
| Compound Name | [4-(2,6-dichlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methanol |
|---|---|
| PubChem CID | 69259667 |
| Molecular Formula | C14H9Cl2FO3 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | [4-(2,6-dichlorophenyl)-6-fluoro-1,3-benzodioxol-2-yl]methanol |
| SMILES | OCC1Oc2cc(F)cc(-c3c(Cl)cccc3Cl)c2O1 |
| InChI | InChI=1S/C14H9Cl2FO3/c15-9-2-1-3-10(16)13(9)8-4-7(17)5-11-14(8)20-12(6-18)19-11/h1-5,12,18H,6H2 |
| InChIKey | PKBVYRDATYUDFI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |