C10H11N3O2 — CID 150386089
3-(2-azidoethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 150386089) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-(2-azidoethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(2-azidoethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 150386089 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-(2-azidoethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | [N-]=[N+]=NCCC1COc2ccccc2O1 |
| InChI | InChI=1S/C10H11N3O2/c11-13-12-6-5-8-7-14-9-3-1-2-4-10(9)15-8/h1-4,8H,5-7H2 |
| InChIKey | HASOTCYWDQWOLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|