C10H13N3O2S — CID 77061065
2,3-dihydro-1,4-benzodioxin-3-ylmethyl N'-aminocarbamimidothioate (PubChem CID 77061065) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-ylmethyl N'-aminocarbamimidothioate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-ylmethyl N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77061065 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-ylmethyl N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC1COc2ccccc2O1 |
| InChI | InChI=1S/C10H13N3O2S/c11-10(13-12)16-6-7-5-14-8-3-1-2-4-9(8)15-7/h1-4,7H,5-6,12H2,(H2,11,13) |
| InChIKey | ZFPMJMIBXFQTPK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|