C14H12O2 — CID 22344656
4-(2-methylphenyl)-1,3-benzodioxole (PubChem CID 22344656) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-(2-methylphenyl)-1,3-benzodioxole.
| Compound Name | 4-(2-methylphenyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 22344656 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-(2-methylphenyl)-1,3-benzodioxole |
| SMILES | Cc1ccccc1-c1cccc2c1OCO2 |
| InChI | InChI=1S/C14H12O2/c1-10-5-2-3-6-11(10)12-7-4-8-13-14(12)16-9-15-13/h2-8H,9H2,1H3 |
| InChIKey | NYFYKMKFYHNBEC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |