C12H10O2 — CID 90367464
5-methylbenzo[g][1,3]benzodioxole (PubChem CID 90367464) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 5-methylbenzo[g][1,3]benzodioxole.
| Compound Name | 5-methylbenzo[g][1,3]benzodioxole |
|---|---|
| PubChem CID | 90367464 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 5-methylbenzo[g][1,3]benzodioxole |
| SMILES | Cc1cc2c(c3ccccc13)OCO2 |
| InChI | InChI=1S/C12H10O2/c1-8-6-11-12(14-7-13-11)10-5-3-2-4-9(8)10/h2-6H,7H2,1H3 |
| InChIKey | LHQQPWVTQUDHIQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |