C18H16NO2+ — CID 123457115
2-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)isoquinolin-2-ium (PubChem CID 123457115) has the molecular formula C18H16NO2+ and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)isoquinolin-2-ium.
| Compound Name | 2-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 123457115 |
| Molecular Formula | C18H16NO2+ |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-methyl-1-(6-methyl-1,3-benzodioxol-5-yl)isoquinolin-2-ium |
| SMILES | Cc1cc2c(cc1-c1c3ccccc3cc[n+]1C)OCO2 |
| InChI | InChI=1S/C18H16NO2/c1-12-9-16-17(21-11-20-16)10-15(12)18-14-6-4-3-5-13(14)7-8-19(18)2/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | FODDAQZBQYHJPW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|