C19H16NO2+ — CID 138971951
21-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,13,15,17,19-octaene (PubChem CID 138971951) has the molecular formula C19H16NO2+ and a molecular weight of 290.34 g/mol. Its IUPAC name is 21-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,13,15,17,19-octaene.
| Compound Name | 21-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,13,15,17,19-octaene |
|---|---|
| PubChem CID | 138971951 |
| Molecular Formula | C19H16NO2+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 21-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,13,15,17,19-octaene |
| SMILES | Cc1c2[n+](cc3ccccc13)CCc1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C19H16NO2/c1-12-15-5-3-2-4-14(15)10-20-7-6-13-8-17-18(22-11-21-17)9-16(13)19(12)20/h2-5,8-10H,6-7,11H2,1H3/q+1 |
| InChIKey | GIQPMURRRXXPRJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|