C26H19N2O6+ — CID 118713481
24-[(4-nitrophenyl)methyl]-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaene (PubChem CID 118713481) has the molecular formula C26H19N2O6+ and a molecular weight of 455.45 g/mol. Its IUPAC name is 24-[(4-nitrophenyl)methyl]-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaene.
| Compound Name | 24-[(4-nitrophenyl)methyl]-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaene |
|---|---|
| PubChem CID | 118713481 |
| Molecular Formula | C26H19N2O6+ |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 24-[(4-nitrophenyl)methyl]-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaene |
| SMILES | O=[N+]([O-])c1ccc(Cc2c3[n+](cc4c5c(ccc24)OCO5)CCc2cc4c(cc2-3)OCO4)cc1 |
| InChI | InChI=1S/C26H19N2O6/c29-28(30)17-3-1-15(2-4-17)9-20-18-5-6-22-26(34-14-31-22)21(18)12-27-8-7-16-10-23-24(33-13-32-23)11-19(16)25(20)27/h1-6,10-12H,7-9,13-14H2/q+1 |
| InChIKey | MKAACFCPRZDIAT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|