C21H15N4O4+ — CID 7642868
4-amino-2-(4-nitrophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile (PubChem CID 7642868) has the molecular formula C21H15N4O4+ and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-amino-2-(4-nitrophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile.
| Compound Name | 4-amino-2-(4-nitrophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7642868 |
| Molecular Formula | C21H15N4O4+ |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-amino-2-(4-nitrophenyl)-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizin-5-ium-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc([N+](=O)[O-])cc2)cc2[n+](c1N)CCc1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C21H14N4O4/c22-10-17-15(12-1-3-14(4-2-12)25(26)27)8-18-16-9-20-19(28-11-29-20)7-13(16)5-6-24(18)21(17)23/h1-4,7-9,23H,5-6,11H2/p+1 |
| InChIKey | ROSYGBOEQGMZTP-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|