C25H16N4O4 — CID 4659159
2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-phenylphenyl)pyridine-3-carbonitrile (PubChem CID 4659159) has the molecular formula C25H16N4O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-phenylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-phenylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4659159 |
| Molecular Formula | C25H16N4O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-phenylphenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cc3c(cc2[N+](=O)[O-])OCO3)cc(-c2ccc(-c3ccccc3)cc2)nc1N |
| InChI | InChI=1S/C25H16N4O4/c26-13-20-18(19-11-23-24(33-14-32-23)12-22(19)29(30)31)10-21(28-25(20)27)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-12H,14H2,(H2,27,28) |
| InChIKey | SNMFXSCOJRXKEX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|