C22H18N4O4 — CID 5088047
2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-propylphenyl)pyridine-3-carbonitrile (PubChem CID 5088047) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-propylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-propylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5088047 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-amino-4-(6-nitro-1,3-benzodioxol-5-yl)-6-(4-propylphenyl)pyridine-3-carbonitrile |
| SMILES | CCCc1ccc(-c2cc(-c3cc4c(cc3[N+](=O)[O-])OCO4)c(C#N)c(N)n2)cc1 |
| InChI | InChI=1S/C22H18N4O4/c1-2-3-13-4-6-14(7-5-13)18-8-15(17(11-23)22(24)25-18)16-9-20-21(30-12-29-20)10-19(16)26(27)28/h4-10H,2-3,12H2,1H3,(H2,24,25) |
| InChIKey | OEATUTHNTJIPNN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|