C19H12N4O4 — CID 5254075
2-amino-4-(1,3-benzodioxol-5-yl)-6-(3-nitrophenyl)pyridine-3-carbonitrile (PubChem CID 5254075) has the molecular formula C19H12N4O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzodioxol-5-yl)-6-(3-nitrophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(1,3-benzodioxol-5-yl)-6-(3-nitrophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5254075 |
| Molecular Formula | C19H12N4O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-amino-4-(1,3-benzodioxol-5-yl)-6-(3-nitrophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc3c(c2)OCO3)cc(-c2cccc([N+](=O)[O-])c2)nc1N |
| InChI | InChI=1S/C19H12N4O4/c20-9-15-14(11-4-5-17-18(7-11)27-10-26-17)8-16(22-19(15)21)12-2-1-3-13(6-12)23(24)25/h1-8H,10H2,(H2,21,22) |
| InChIKey | ANOKCZYOLWEOGZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|