C16H13BrN2O4 — CID 71764941
6-(4-nitrophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide (PubChem CID 71764941) has the molecular formula C16H13BrN2O4 and a molecular weight of 377.19 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide.
| Compound Name | 6-(4-nitrophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide |
|---|---|
| PubChem CID | 71764941 |
| Molecular Formula | C16H13BrN2O4 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 6-(4-nitrophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide |
| SMILES | O=[N+]([O-])c1ccc([N+]2=Cc3cc4c(cc3CC2)OCO4)cc1.[Br-] |
| InChI | InChI=1S/C16H13N2O4.BrH/c19-18(20)14-3-1-13(2-4-14)17-6-5-11-7-15-16(22-10-21-15)8-12(11)9-17;/h1-4,7-9H,5-6,10H2;1H/q+1;/p-1 |
| InChIKey | OFWNRKQORWSCAL-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|