C14H9NO6 — CID 28888032
2-(1,3-benzodioxol-5-yloxy)-5-nitrobenzaldehyde (PubChem CID 28888032) has the molecular formula C14H9NO6 and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-5-nitrobenzaldehyde.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-5-nitrobenzaldehyde |
|---|---|
| PubChem CID | 28888032 |
| Molecular Formula | C14H9NO6 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-5-nitrobenzaldehyde |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H9NO6/c16-7-9-5-10(15(17)18)1-3-12(9)21-11-2-4-13-14(6-11)20-8-19-13/h1-7H,8H2 |
| InChIKey | VPOUXGWRJXAQMG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|