C13H9NO4 — CID 114055648
2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbaldehyde (PubChem CID 114055648) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbaldehyde.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 114055648 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cccnc1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H9NO4/c15-7-9-2-1-5-14-13(9)18-10-3-4-11-12(6-10)17-8-16-11/h1-7H,8H2 |
| InChIKey | NNPWZCYLGSADBU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|