C14H10N2O7 — CID 24561546
6-(2,4-dinitrophenoxy)-2,3-dihydro-1,4-benzodioxine (PubChem CID 24561546) has the molecular formula C14H10N2O7 and a molecular weight of 318.24 g/mol. Its IUPAC name is 6-(2,4-dinitrophenoxy)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(2,4-dinitrophenoxy)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 24561546 |
| Molecular Formula | C14H10N2O7 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 6-(2,4-dinitrophenoxy)-2,3-dihydro-1,4-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc3c(c2)OCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N2O7/c17-15(18)9-1-3-12(11(7-9)16(19)20)23-10-2-4-13-14(8-10)22-6-5-21-13/h1-4,7-8H,5-6H2 |
| InChIKey | IHHXYRLAKDAGLP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|