C13H11N3O5 — CID 80909958
[3-(1,3-benzodioxol-5-yloxy)-2-nitrophenyl]hydrazine (PubChem CID 80909958) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-yloxy)-2-nitrophenyl]hydrazine.
| Compound Name | [3-(1,3-benzodioxol-5-yloxy)-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 80909958 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [3-(1,3-benzodioxol-5-yloxy)-2-nitrophenyl]hydrazine |
| SMILES | NNc1cccc(Oc2ccc3c(c2)OCO3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N3O5/c14-15-9-2-1-3-11(13(9)16(17)18)21-8-4-5-10-12(6-8)20-7-19-10/h1-6,15H,7,14H2 |
| InChIKey | LHOFHJWSQAZPNH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|