C15H14N2O5 — CID 60504910
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-nitroaniline (PubChem CID 60504910) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-nitroaniline.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 60504910 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-nitroaniline |
| SMILES | O=[N+]([O-])c1ccccc1NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14N2O5/c18-17(19)13-4-2-1-3-12(13)16-7-8-20-11-5-6-14-15(9-11)22-10-21-14/h1-6,9,16H,7-8,10H2 |
| InChIKey | SMRQFZJARRSBMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|