C17H15N3O3 — CID 60504727
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]quinoxalin-2-amine (PubChem CID 60504727) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]quinoxalin-2-amine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 60504727 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]quinoxalin-2-amine |
| SMILES | c1ccc2nc(NCCOc3ccc4c(c3)OCO4)cnc2c1 |
| InChI | InChI=1S/C17H15N3O3/c1-2-4-14-13(3-1)19-10-17(20-14)18-7-8-21-12-5-6-15-16(9-12)23-11-22-15/h1-6,9-10H,7-8,11H2,(H,18,20) |
| InChIKey | FBJMJAJURDOOAR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|