C17H16N4O4 — CID 23610176
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(benzotriazol-1-yl)acetamide (PubChem CID 23610176) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(benzotriazol-1-yl)acetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(benzotriazol-1-yl)acetamide |
|---|---|
| PubChem CID | 23610176 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(benzotriazol-1-yl)acetamide |
| SMILES | O=C(Cn1nnc2ccccc21)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N4O4/c22-17(10-21-14-4-2-1-3-13(14)19-20-21)18-7-8-23-12-5-6-15-16(9-12)25-11-24-15/h1-6,9H,7-8,10-11H2,(H,18,22) |
| InChIKey | VQHWNJYDKQJJJT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|