C16H14N4O3S — CID 133442342
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine (PubChem CID 133442342) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133442342 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(-c2nnc(NCCOc3ccc4c(c3)OCO4)s2)nc1 |
| InChI | InChI=1S/C16H14N4O3S/c1-2-6-17-12(3-1)15-19-20-16(24-15)18-7-8-21-11-4-5-13-14(9-11)23-10-22-13/h1-6,9H,7-8,10H2,(H,18,20) |
| InChIKey | FALAYYMGNAKTIS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|