C17H18N3O5+ — CID 8746243
1,3-benzodioxol-5-ylmethyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium (PubChem CID 8746243) has the molecular formula C17H18N3O5+ and a molecular weight of 344.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8746243 |
| Molecular Formula | C17H18N3O5+ |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1[N+](=O)[O-])Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17N3O5/c1-19(9-12-6-7-15-16(8-12)25-11-24-15)10-17(21)18-13-4-2-3-5-14(13)20(22)23/h2-8H,9-11H2,1H3,(H,18,21)/p+1 |
| InChIKey | IIQBOKLORGUXED-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|