C16H16Cl2N3O3+ — CID 9039683
(2,3-dichlorophenyl)methyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9039683) has the molecular formula C16H16Cl2N3O3+ and a molecular weight of 369.23 g/mol. Its IUPAC name is (2,3-dichlorophenyl)methyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | (2,3-dichlorophenyl)methyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9039683 |
| Molecular Formula | C16H16Cl2N3O3+ |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (2,3-dichlorophenyl)methyl-methyl-[2-(2-nitroanilino)-2-oxoethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1[N+](=O)[O-])Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-20(9-11-5-4-6-12(17)16(11)18)10-15(22)19-13-7-2-3-8-14(13)21(23)24/h2-8H,9-10H2,1H3,(H,19,22)/p+1 |
| InChIKey | RKOVEXBEEJBXDV-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|