C15H15Cl3N3O+ — CID 8678630
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dichlorophenyl)methyl]-methylazanium (PubChem CID 8678630) has the molecular formula C15H15Cl3N3O+ and a molecular weight of 359.66 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dichlorophenyl)methyl]-methylazanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dichlorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8678630 |
| Molecular Formula | C15H15Cl3N3O+ |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dichlorophenyl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1cccnc1Cl)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H14Cl3N3O/c1-21(8-10-4-2-5-11(16)14(10)17)9-13(22)20-12-6-3-7-19-15(12)18/h2-7H,8-9H2,1H3,(H,20,22)/p+1 |
| InChIKey | WKVXBHNRKPHIGI-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|