C16H16Cl3N4O2+ — CID 8559526
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8559526) has the molecular formula C16H16Cl3N4O2+ and a molecular weight of 402.69 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8559526 |
| Molecular Formula | C16H16Cl3N4O2+ |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1cccnc1Cl)CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H15Cl3N4O2/c1-23(8-13(24)21-12-6-3-7-20-16(12)19)9-14(25)22-15-10(17)4-2-5-11(15)18/h2-7H,8-9H2,1H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | DBRHFOAWCAKINP-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|