C17H18Cl2N3O2+ — CID 9287215
(2-anilino-2-oxoethyl)-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9287215) has the molecular formula C17H18Cl2N3O2+ and a molecular weight of 367.26 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl)-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (2-anilino-2-oxoethyl)-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9287215 |
| Molecular Formula | C17H18Cl2N3O2+ |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2-anilino-2-oxoethyl)-[2-(2,6-dichloroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1)CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-22(10-15(23)20-12-6-3-2-4-7-12)11-16(24)21-17-13(18)8-5-9-14(17)19/h2-9H,10-11H2,1H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | RYYPMDXVAKKBMN-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |