C17H19Cl2N2O+ — CID 8541446
benzyl-[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylazanium (PubChem CID 8541446) has the molecular formula C17H19Cl2N2O+ and a molecular weight of 338.26 g/mol. Its IUPAC name is benzyl-[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylazanium.
| Compound Name | benzyl-[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8541446 |
| Molecular Formula | C17H19Cl2N2O+ |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | benzyl-[2-(2,6-dichloroanilino)-2-oxoethyl]-ethylazanium |
| SMILES | CC[NH+](CC(=O)Nc1c(Cl)cccc1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C17H18Cl2N2O/c1-2-21(11-13-7-4-3-5-8-13)12-16(22)20-17-14(18)9-6-10-15(17)19/h3-10H,2,11-12H2,1H3,(H,20,22)/p+1 |
| InChIKey | BUZAFIKGCWKHCN-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |